112581-77-8 Usage
Uses
Used in Pharmaceutical Industry:
2,6-Dichloroimidazo[1,2-b]pyridazine is used as a pharmaceutical agent for its potential anti-tumor and anti-inflammatory properties. Its unique chemical structure allows it to interact with biological targets, making it a promising candidate for the development of new drugs to treat various diseases.
Used in Agrochemical Industry:
In the agrochemical industry, 2,6-dichloroimidazo[1,2-b]pyridazine is used as a precursor in the development of pesticides and herbicides. Its structural properties make it suitable for the creation of compounds that can effectively control pests and weeds, thereby enhancing crop protection and yield.
Used in Electronic Materials:
2,6-Dichloroimidazo[1,2-b]pyridazine is also being studied for its potential use in electronic materials. Its unique electronic properties, such as its ability to form stable complexes with other molecules, make it a candidate for applications in areas like organic light-emitting diodes (OLEDs) and organic field-effect transistors (OFETs), where novel materials with specific characteristics are constantly sought after.
Check Digit Verification of cas no
The CAS Registry Mumber 112581-77-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,2,5,8 and 1 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 112581-77:
(8*1)+(7*1)+(6*2)+(5*5)+(4*8)+(3*1)+(2*7)+(1*7)=108
108 % 10 = 8
So 112581-77-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H3Cl2N3/c7-4-1-2-6-9-5(8)3-11(6)10-4/h1-3H
