112898-10-9 Usage
Uses
Used in Biochemical Applications:
2-ACETAMIDO-N-(E-AMINOCAPROYL)-2-DEOXY-BETA-D-GLUCOPYRANOSYLAMINE is used as a ligand for the separation of hexosaminidases using affinity chromatography. Its unique structure allows for specific binding to hexosaminidases, enabling their purification and isolation from complex biological mixtures.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-ACETAMIDO-N-(E-AMINOCAPROYL)-2-DEOXY-BETA-D-GLUCOPYRANOSYLAMINE is used as a potential therapeutic agent. Its ability to interact with various biological systems makes it a promising candidate for the development of new drugs targeting specific diseases.
Used in Chemical Research:
2-ACETAMIDO-N-(E-AMINOCAPROYL)-2-DEOXY-BETA-D-GLUCOPYRANOSYLAMINE is also used in chemical research as a model compound to study the interactions between carbohydrates and proteins. This can provide valuable insights into the mechanisms of various biological processes and help in the design of new drugs and therapies.
Used in Material Science:
The unique chemical properties of 2-ACETAMIDO-N-(E-AMINOCAPROYL)-2-DEOXY-BETA-D-GLUCOPYRANOSYLAMINE make it a candidate for use in the development of new materials with specific properties, such as improved biocompatibility or targeted drug delivery capabilities.
Check Digit Verification of cas no
The CAS Registry Mumber 112898-10-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,2,8,9 and 8 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 112898-10:
(8*1)+(7*1)+(6*2)+(5*8)+(4*9)+(3*8)+(2*1)+(1*0)=129
129 % 10 = 9
So 112898-10-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H27N3O6/c1-8(19)16-11-13(22)12(21)9(7-18)23-14(11)17-10(20)5-3-2-4-6-15/h9,11-14,18,21-22H,2-7,15H2,1H3,(H,16,19)(H,17,20)