112926-02-0 Usage
Chemical Properties
yellow solid
Uses
Different sources of media describe the Uses of 112926-02-0 differently. You can refer to the following data:
1. INDO 1/AM is a cell permeable derivative of INDO 1.
2. Cell permeable fluorescent probe for Ca2+; lower affinity than FURA?2; gives a large shift in fluorescent emission from 482?nm to 398?nm upon Ca2+ binding.
3. Cell-permeant derivative of Indo 1. Indo 1-AM is fluorescent probe for Ca2+. After crossing the membrane, the product is rapidly hydrolyzed by cytoplasmic esterases to the membrane impermeant INDO 1. Indo 1-AM is possible using for ratiometric fluorescenc
Check Digit Verification of cas no
The CAS Registry Mumber 112926-02-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,2,9,2 and 6 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 112926-02:
(8*1)+(7*1)+(6*2)+(5*9)+(4*2)+(3*6)+(2*0)+(1*2)=100
100 % 10 = 0
So 112926-02-0 is a valid CAS Registry Number.
InChI:InChI=1/C33H34N2O17/c1-19(36)45-15-49-30(40)12-35(13-31(41)50-16-46-20(2)37)28-8-7-24(11-29(28)44-14-32(42)51-17-47-21(3)38)26-9-23-5-6-25(10-27(23)34-26)33(43)52-18-48-22(4)39/h5-11,34H,12-18H2,1-4H3