112928-27-5 Usage
Uses
Used in Pharmaceutical Synthesis:
6-Quinoxalinamine, 2-chlorois utilized as a key intermediate in the synthesis of various pharmaceuticals and organic compounds. Its unique structure and functional groups make it a valuable building block for the development of new drugs and chemical entities.
Used in Antimicrobial Applications:
Due to its antimicrobial properties, 6-Quinoxalinamine, 2-chlorocan be employed as an antimicrobial agent in various applications, such as in the development of antibiotics, antifungal agents, and disinfectants. Its ability to inhibit the growth of microorganisms makes it a promising candidate for combating infections and promoting public health.
Used in Anti-inflammatory Applications:
6-Quinoxalinamine, 2-chlorohas demonstrated anti-inflammatory properties, making it a potential candidate for use in the development of anti-inflammatory drugs. It can be used to alleviate inflammation and associated symptoms in various medical conditions, such as arthritis, asthma, and other inflammatory disorders.
Used in Cancer Treatment Research:
6-Quinoxalinamine, 2-chlorohas been studied for its potential use in the treatment of cancer. Its biological activities and interactions with cellular targets make it a promising candidate for further research into its anticancer properties. While more investigation is needed, it may eventually contribute to the development of novel therapeutic agents for cancer treatment.
Used in Chemical Research:
As a quinoxaline derivative with a chlorine atom, 6-Quinoxalinamine, 2-chlorois also used in chemical research to explore its reactivity, stability, and potential applications in various chemical processes. Its unique structure and properties can provide insights into the development of new synthetic methods and the discovery of new chemical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 112928-27-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,2,9,2 and 8 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 112928-27:
(8*1)+(7*1)+(6*2)+(5*9)+(4*2)+(3*8)+(2*2)+(1*7)=115
115 % 10 = 5
So 112928-27-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H6ClN3/c9-8-4-11-7-3-5(10)1-2-6(7)12-8/h1-4H,10H2
112928-27-5Relevant articles and documents
From simple quinoxalines to potent oxazolo[5,4-: F] quinoxaline inhibitors of glycogen-synthase kinase 3 (GSK3)
Lassagne, Frédéric,Duguépéroux, Camille,Roca, Carlos,Perez, Concepcion,Martinez, Ana,Baratte, Blandine,Robert, Thomas,Ruchaud, Sandrine,Bach, Stéphane,Erb, William,Roisnel, Thierry,Mongin, Florence
, p. 154 - 162 (2019)
2,7-Disubstituted oxazolo[5,4-f]quinoxalines were synthesized from 6-amino-2-chloroquinoxaline in four steps (iodination at C5, substitution of the chloro group, amidation and copper-catalysed cyclization) affording 28 to 44% overall yields. 2,8-Disubstituted oxazolo[5,4-f]quinoxaline was similarly obtained from 6-amino-3-chloroquinoxaline (39% overall yield). For the synthesis of other oxazolo[5,4-f]quinoxalines, amidation was rather performed before substitution; moreover, time-consuming purification steps were avoided between the amines and the final products (38 to 54% overall yields). Finally, a more efficient method involving merging of the last two steps in a sequential process was developed to access more derivatives (37 to 65% overall yields). Most of the oxazolo[5,4-f]quinoxalines were evaluated for their activity on a panel of protein kinases, and a few 2,8-disubstituted derivatives proved to inhibit GSK3 kinase. While experiments showed an ATP-competitive inhibition on GSK3β, structure-activity relationships allowed us to identify 2-(3-pyridyl)-8-(thiomorpholino)oxazolo[5,4-f]quinoxaline as the most potent inhibitor with an IC50 value of about 5 nM on GSK3α.
