1132-96-3 Usage
Uses
Used in Pharmaceutical Industry:
4,4-Dipropyl-2,6-piperidinedione is used as a central nervous system depressant for its sedative and anesthetic properties, making it a potential candidate for the development of medications targeting anxiety, insomnia, and other conditions requiring CNS depression.
Used as a Precursor in Synthesis:
In the Pharmaceutical and Agrochemical Industries, 4,4-Dipropyl-2,6-piperidinedione serves as a precursor in the synthesis of various pharmaceuticals and agrochemicals, contributing to the development of new drugs and pesticides.
Used in Organic Chemistry as a Reagent:
4,4-Dipropyl-2,6-piperidinedione is utilized as a reagent in organic chemistry reactions due to its unique structure, facilitating the production of other complex organic molecules and aiding in the advancement of organic synthesis techniques.
Check Digit Verification of cas no
The CAS Registry Mumber 1132-96-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,1,3 and 2 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1132-96:
(6*1)+(5*1)+(4*3)+(3*2)+(2*9)+(1*6)=53
53 % 10 = 3
So 1132-96-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H19NO2/c1-3-5-11(6-4-2)7-9(13)12-10(14)8-11/h3-8H2,1-2H3,(H,12,13,14)
