113221-74-2 Usage
Uses
Used in Pharmaceutical Industry:
5-Mercapto-(1H)-tetrazolylacetic acid sodium salt is used as a building block in the synthesis of various drugs, primarily for the treatment of cardiovascular diseases. Its unique structure allows it to be a key component in the development of new medications.
Used in Cardiovascular Medications:
In the field of cardiovascular medicine, 5-Mercapto-(1H)-tetrazolylacetic acid sodium salt is used as a potent inhibitor of angiotensin converting enzyme (ACE). This makes it a valuable compound for the development of new medications aimed at treating hypertension and other cardiovascular disorders by regulating the renin-angiotensin system.
Used in Organic Synthesis:
Beyond its pharmaceutical applications, 5-Mercapto-(1H)-tetrazolylacetic acid sodium salt also has potential uses in organic synthesis, where it can contribute to the creation of complex organic molecules with specific therapeutic properties.
Used in Chemical Research:
In the realm of chemical research, 5-MERCAPTO-(1H)-TETRAZOLYLACETIC ACID SODIUM SALT is utilized for its unique chemical properties, providing insights into the behavior of tetrazole rings and thiol groups in various chemical reactions and processes.
Check Digit Verification of cas no
The CAS Registry Mumber 113221-74-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,3,2,2 and 1 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 113221-74:
(8*1)+(7*1)+(6*3)+(5*2)+(4*2)+(3*1)+(2*7)+(1*4)=72
72 % 10 = 2
So 113221-74-2 is a valid CAS Registry Number.
InChI:InChI=1/C3H4N4O2S.Na/c8-2(9)1-7-3(10)4-5-6-7;/h1H2,(H,8,9)(H,4,6,10);/q;+1/p-1
