1133-96-6 Usage
Uses
Used in Chemical Industry:
3-(2,4-dimethyl-5-formyl-1H-pyrrole-3-yl)propanoic acid is used as a building block for the synthesis of various complex organic compounds, leveraging its unique structure and functional groups to create novel molecules with potential applications in material science and other fields.
Used in Pharmaceutical Industry:
3-(2,4-dimethyl-5-formyl-1H-pyrrole-3-yl)propanoic acid is used as a precursor in the development of new pharmaceutical compounds, potentially serving as a key intermediate in the synthesis of drugs with novel therapeutic properties. Its structure may allow for the creation of molecules with specific binding affinities or activities, making it a valuable asset in drug discovery and design.
Check Digit Verification of cas no
The CAS Registry Mumber 1133-96-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,1,3 and 3 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1133-96:
(6*1)+(5*1)+(4*3)+(3*3)+(2*9)+(1*6)=56
56 % 10 = 6
So 1133-96-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H13NO3/c1-6-8(3-4-10(13)14)7(2)11-9(6)5-12/h5,11H,3-4H2,1-2H3,(H,13,14)
