113366-20-4 Usage
General Description
The chemical compound (Z)-2-(2,5-dimethylphenyl)-3-(2-nitrophenyl)prop-2-enenitrile is a yellow crystalline powder with the molecular formula C17H14N2O2. It is a nitrile derivative with a unique structure that contains two different aromatic rings and a nitrile group. (Z)-2-(2,5-dimethylphenyl)-3-(2-nitrophenyl)prop-2-enenitrile has potential applications in organic synthesis and medicinal chemistry, where its unique chemical structure may be used as a building block for the synthesis of other complex molecules. Additionally, it may have biological activities that make it interesting for further study in drug discovery and development. However, further research is necessary to fully understand its properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 113366-20-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,3,3,6 and 6 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 113366-20:
(8*1)+(7*1)+(6*3)+(5*3)+(4*6)+(3*6)+(2*2)+(1*0)=94
94 % 10 = 4
So 113366-20-4 is a valid CAS Registry Number.
InChI:InChI=1/C17H14N2O2/c1-12-7-8-13(2)16(9-12)15(11-18)10-14-5-3-4-6-17(14)19(20)21/h3-10H,1-2H3/b15-10+