113380-34-0 Usage
Uses
Used in Pharmaceutical Industry:
2,4-DIMETHYL-3-(CARBETHOXY PROPYL)-PYRROLE-5-CARBOXYLIC ACID is used as a pharmaceutical compound for its potential therapeutic effects. Its unique structure and functional groups may contribute to the development of new drugs with specific target interactions and biological activities.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 2,4-DIMETHYL-3-(CARBETHOXY PROPYL)-PYRROLE-5-CARBOXYLIC ACID serves as a valuable research tool. Its distinctive chemical properties and potential interactions with biological targets make it an interesting subject for exploring novel drug candidates and understanding their mechanisms of action.
Used in Drug Development:
2,4-DIMETHYL-3-(CARBETHOXY PROPYL)-PYRROLE-5-CARBOXYLIC ACID is utilized in drug development as a starting material or a key intermediate in the synthesis of new pharmaceutical agents. Its unique structural features and functional groups can be further modified or optimized to enhance the potency, selectivity, and pharmacokinetic properties of the resulting drug molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 113380-34-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,3,3,8 and 0 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 113380-34:
(8*1)+(7*1)+(6*3)+(5*3)+(4*8)+(3*0)+(2*3)+(1*4)=90
90 % 10 = 0
So 113380-34-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H17NO4/c1-4-17-10(14)6-5-9-7(2)11(12(15)16)13-8(9)3/h13H,4-6H2,1-3H3,(H,15,16)
