113402-89-4 Usage
Uses
Used in Pharmaceutical Industry:
3-Methyl-1H-pyrazol-5-amine is used as a building block for the synthesis of various bioactive compounds due to its chemical properties and reactivity, contributing to the development of new pharmaceutical agents.
Used in Anticancer Drug Development:
3-Methyl-1H-pyrazol-5-amine is used as a potential anticancer agent for its antiproliferative and cytotoxic properties, making it a candidate for further research and development in the creation of new cancer treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 113402-89-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,3,4,0 and 2 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 113402-89:
(8*1)+(7*1)+(6*3)+(5*4)+(4*0)+(3*2)+(2*8)+(1*9)=84
84 % 10 = 4
So 113402-89-4 is a valid CAS Registry Number.
InChI:InChI=1S/C4H7N3/c1-3-2-4(5)7-6-3/h2H,1H3,(H3,5,6,7)
