1136-60-3 Usage
Uses
Used in Pharmaceutical Industry:
(5-chloro-3-methyl-1-phenyl-pyrazol-4-yl)methanol is used as a potential candidate for the development of new drugs due to its unique structural and chemical properties. Its specific role in drug development would need to be further investigated through research and experimentation.
Used as a Reagent in Chemical Synthesis:
(5-chloro-3-methyl-1-phenyl-pyrazol-4-yl)methanol may be utilized as a reagent in chemical synthesis processes, contributing to the formation of desired products or facilitating specific reactions.
Used as an Intermediate in Production of Other Compounds:
(5-chloro-3-methyl-1-phenyl-pyrazol-4-yl)methanol may also serve as an intermediate in the production of other complex organic compounds, playing a crucial role in multi-step synthesis processes.
Check Digit Verification of cas no
The CAS Registry Mumber 1136-60-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,1,3 and 6 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 1136-60:
(6*1)+(5*1)+(4*3)+(3*6)+(2*6)+(1*0)=53
53 % 10 = 3
So 1136-60-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H11ClN2O/c1-8-10(7-15)11(12)14(13-8)9-5-3-2-4-6-9/h2-6,15H,7H2,1H3
1136-60-3Relevant academic research and scientific papers
Imidazolylethoxymethyl derivatives of pyrazole
-
, (2008/06/13)
Compounds are provided having the structure STR1 wherein R1 and R2 may be the same or different and each may be hydrogen, lower alkyl, phenyl-lower alkyl, phenyl, substituted phenyl wherein the phenyl group bears one halogen, hydroxy
