113812-31-0 Usage
Description
1-(1-phenylcyclohexyl)-2,3-dihydro-4-pyridone is a cyclohexylpyridone derivative with the molecular formula C17H19NO. It is a chemical compound that features a phenylcyclohexyl group attached to a dihydro-4-pyridone moiety, making it a valuable building block in medicinal chemistry for the synthesis of drugs with potential biological activity.
Uses
Used in Pharmaceutical Synthesis:
1-(1-phenylcyclohexyl)-2,3-dihydro-4-pyridone is used as an intermediate in the synthesis of various pharmaceutical compounds. Its unique chemical structure allows it to be a key component in creating drugs with potential therapeutic applications.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 1-(1-phenylcyclohexyl)-2,3-dihydro-4-pyridone is used as a building block for the development of new pharmaceutical drugs. Researchers are interested in its synthesis and chemical properties to understand how it can be utilized in creating novel drugs with improved efficacy and safety profiles.
Used in Drug Development:
1-(1-phenylcyclohexyl)-2,3-dihydro-4-pyridone has potential applications in the development of new pharmaceutical drugs. Its incorporation into drug molecules can lead to the creation of compounds with enhanced biological activity, making it a promising candidate for further research and development in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 113812-31-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,3,8,1 and 2 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 113812-31:
(8*1)+(7*1)+(6*3)+(5*8)+(4*1)+(3*2)+(2*3)+(1*1)=90
90 % 10 = 0
So 113812-31-0 is a valid CAS Registry Number.
InChI:InChI=1/C17H21NO/c19-16-9-13-18(14-10-16)17(11-5-2-6-12-17)15-7-3-1-4-8-15/h1,3-4,7-9,13H,2,5-6,10-12,14H2