1139-11-3 Usage
Uses
Used in Organic Synthesis:
3-AMINO-5-ETHYL-5-PHENYLIMIDAZOLIDINE-2,4-DIONE is used as a building block in organic synthesis for the creation of various chemical compounds. Its unique structure allows for the formation of diverse molecules with potential applications in different fields.
Used in Pharmaceutical Research:
In Pharmaceutical Research, 3-AMINO-5-ETHYL-5-PHENYLIMIDAZOLIDINE-2,4-DIONE is utilized as a precursor for the development of bioactive compounds. Its structural features make it a promising candidate for the synthesis of potential drug candidates with therapeutic properties.
Used in Medicinal Chemistry:
3-AMINO-5-ETHYL-5-PHENYLIMIDAZOLIDINE-2,4-DIONE may have potential applications in the field of medicinal chemistry due to its structural and pharmacological properties. Its heterocyclic nature and functional groups can be exploited to design and optimize compounds with specific biological activities, targeting various therapeutic areas.
Check Digit Verification of cas no
The CAS Registry Mumber 1139-11-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,1,3 and 9 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 1139-11:
(6*1)+(5*1)+(4*3)+(3*9)+(2*1)+(1*1)=53
53 % 10 = 3
So 1139-11-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H13N3O2/c1-2-11(8-6-4-3-5-7-8)9(15)14(12)10(16)13-11/h3-7H,2,12H2,1H3,(H,13,16)/t11-/m0/s1
