113996-88-6 Usage
Description
2,3-dibromoacrolein O-methyloxime is a chemical compound derived from acrolein, a highly reactive and toxic substance. The addition of the O-methyloxime group to the 2,3-dibromoacrolein molecule enhances its stability and reduces its reactivity, making it a safer and more manageable reagent for various chemical reactions. It is primarily used in organic chemistry as a reagent, and its synthesis and development contribute to the creation of new pharmaceuticals and agrochemicals.
Uses
Used in Organic Chemistry:
2,3-dibromoacrolein O-methyloxime is used as a reagent in organic chemistry for its ability to participate in various chemical reactions, providing a safer alternative to the highly reactive acrolein.
Used in Pharmaceutical Development:
2,3-dibromoacrolein O-methyloxime is used as a key intermediate in the synthesis of organic molecules, which are essential in the development of new pharmaceuticals. Its stable nature allows for more controlled reactions, leading to the production of desired compounds with fewer side effects.
Used in Agrochemical Development:
Similarly, in the agrochemical industry, 2,3-dibromoacrolein O-methyloxime is utilized as a reagent in the synthesis of organic molecules that form the basis of new agrochemicals, such as pesticides and herbicides. Its application ensures a more stable and effective final product.
It is crucial to handle 2,3-dibromoacrolein O-methyloxime with care, as it remains a potentially hazardous chemical despite its increased stability compared to acrolein. Proper safety measures should be taken during its use to minimize risks.
Check Digit Verification of cas no
The CAS Registry Mumber 113996-88-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,3,9,9 and 6 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 113996-88:
(8*1)+(7*1)+(6*3)+(5*9)+(4*9)+(3*6)+(2*8)+(1*8)=156
156 % 10 = 6
So 113996-88-6 is a valid CAS Registry Number.
InChI:InChI=1/C4H7Br2NO/c1-8-7-3-4(6)2-5/h3-4H,2H2,1H3/b7-3+