114-27-2 Usage
Uses
Used in Pharmaceutical Industry:
5,6,7,8-tetrahydro-6,7-dimethylpteridine is used as a precursor in the synthesis of various compounds with biological activity for the development of pharmaceuticals. Its involvement in the biosynthesis of tetrahydrobiopterin, a crucial cofactor, makes it a valuable component in the creation of drugs targeting specific biochemical pathways.
Used in Neurological Disorders Research:
In the field of neurology, 5,6,7,8-tetrahydro-6,7-dimethylpteridine is utilized as a research compound to explore its potential in treating neurological disorders. Its role in biochemical processes related to neurotransmitter synthesis and function suggests it may have therapeutic applications in conditions affecting the nervous system.
Used in Biochemical Research:
5,6,7,8-tetrahydro-6,7-dimethylpteridine serves as a key subject in biochemical research to understand its interactions within metabolic pathways and its potential regulatory effects on enzyme activities, particularly those involving aromatic amino acid hydroxylases.
Check Digit Verification of cas no
The CAS Registry Mumber 114-27-2 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,1 and 4 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 114-27:
(5*1)+(4*1)+(3*4)+(2*2)+(1*7)=32
32 % 10 = 2
So 114-27-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H12N4/c1-5-6(2)12-8-7(11-5)3-9-4-10-8/h3-6,11H,1-2H3,(H,9,10,12)
