114040-50-5 Usage
Description
3,4-Difluoro-benzamidine, also known as benzamidine, 3,4-difluoro-, is a chemical compound belonging to the family of Anilines and Derivatives. With the molecular formula C7H6F2N2, this pale yellow to yellow liquid is primarily used in the development of other compounds in laboratories. Its systematic name is 3,4-difluoro-benzenecarboximidamide. Due to its potential hazards, proper handling and safety measures are necessary when working with this chemical.
Uses
Used in Chemical Research and Development:
3,4-Difluoro-benzamidine is used as a chemical intermediate for the synthesis of various compounds in chemical research and development. Its unique structure and properties make it a valuable building block for creating new molecules with specific functions and applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3,4-difluoro-benzamidine is used as a precursor in the synthesis of drug candidates. Its presence in the molecular structure can impart specific biological activities, such as enzyme inhibition or receptor binding, which are essential for the development of new therapeutic agents.
Used in Material Science:
3,4-Difluoro-benzamidine is also utilized in material science for the development of novel materials with unique properties. Its incorporation into polymers or other materials can enhance their performance, such as improving thermal stability, mechanical strength, or chemical resistance.
Check Digit Verification of cas no
The CAS Registry Mumber 114040-50-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,4,0,4 and 0 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 114040-50:
(8*1)+(7*1)+(6*4)+(5*0)+(4*4)+(3*0)+(2*5)+(1*0)=65
65 % 10 = 5
So 114040-50-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H6F2N2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,(H3,10,11)
