1141886-36-3 Usage
Uses
Used in Chemical Synthesis:
5-fluoro-6-hydroxypyridin-3-ylboronic acid is used as a synthetic intermediate for the preparation of various organic compounds. Its unique structure allows for versatile chemical reactions, making it a valuable component in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Suzuki Coupling Reactions:
In the field of organic chemistry, 5-fluoro-6-hydroxypyridin-3-ylboronic acid is used as a reactant in Suzuki coupling reactions. This type of reaction is significant for forming new carbon-carbon bonds using a palladium catalyst. 5-fluoro-6-hydroxypyridin-3-ylboronic acid's boronic acid functionality enables it to participate in cross-coupling reactions with organic halides or triflates, leading to the formation of biaryl compounds, which are prevalent in pharmaceuticals, natural products, and materials science.
Used in Research and Development:
5-fluoro-6-hydroxypyridin-3-ylboronic acid is employed as a research tool in academic and industrial laboratories. Its unique properties and reactivity make it suitable for exploring new reaction pathways, developing novel synthetic methods, and understanding the fundamental aspects of organic and organometallic chemistry.
Used in Pharmaceutical Industry:
5-fluoro-6-hydroxypyridin-3-ylboronic acid is used as a building block in the design and synthesis of new pharmaceutical agents. Its presence in the molecular structure can impart specific biological activities, such as antimicrobial, antiviral, or anticancer properties. 5-fluoro-6-hydroxypyridin-3-ylboronic acid's versatility in chemical reactions allows for the development of diverse drug candidates with potential therapeutic applications.
Used in Materials Science:
In the field of materials science, 5-fluoro-6-hydroxypyridin-3-ylboronic acid is utilized for the development of new materials with unique properties. Its incorporation into polymers, dendrimers, or other macromolecular structures can lead to materials with enhanced thermal stability, mechanical strength, or specific interactions with biological systems. This makes it a valuable component in the creation of advanced materials for various applications, such as sensors, catalysts, or drug delivery systems.
Check Digit Verification of cas no
The CAS Registry Mumber 1141886-36-3 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,1,4,1,8,8 and 6 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1141886-36:
(9*1)+(8*1)+(7*4)+(6*1)+(5*8)+(4*8)+(3*6)+(2*3)+(1*6)=153
153 % 10 = 3
So 1141886-36-3 is a valid CAS Registry Number.
InChI:InChI=1S/C5H5BFNO3/c7-4-1-3(6(10)11)2-8-5(4)9/h1-2,10-11H,(H,8,9)
