1141886-36-3 Usage
General Description
5-fluoro-6-hydroxypyridin-3-ylboronic acid is a chemical compound often used for research purposes, particularly in chemical synthesis and reactions. It belongs to the class of organic compounds known as pyridines and derivatives. It is characterized by a pyridine ring, which is a six-membered aromatic heterocycle, where one carbon atom is replaced by a nitrogen atom. In the compound, the pyridine ring is substituted with fluorine and hydroxyl functional groups at the 5 and 6 positions, respectively. Additionally, the compound contains boronic acid, a compound containing a boron-oxygen (B-O) bond. 5-fluoro-6-hydroxypyridin-3-ylboronic acid may be used in Suzuki coupling reactions—an important type of reaction in organic chemistry which forms new carbon-carbon bonds using a palladium catalyst.
Check Digit Verification of cas no
The CAS Registry Mumber 1141886-36-3 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,1,4,1,8,8 and 6 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1141886-36:
(9*1)+(8*1)+(7*4)+(6*1)+(5*8)+(4*8)+(3*6)+(2*3)+(1*6)=153
153 % 10 = 3
So 1141886-36-3 is a valid CAS Registry Number.
InChI:InChI=1S/C5H5BFNO3/c7-4-1-3(6(10)11)2-8-5(4)9/h1-2,10-11H,(H,8,9)
