114342-15-3 Usage
General Description
H-Gly-OBzl p-Tosylate is a chemical compound commonly used in scientific research. This chemical is a derivative of glycine, one of the smallest and simplest amino acids found in proteins. The OBzl group serves to protect the amine part of the molecule, while the p-tosylate group performs a similar function for the carboxylic acid part of the glycine molecule. H-GLY-OBZL P-TOSYLATE is typically involved in peptide synthesis, as these protective groups are easily removed under specific conditions to allow for bonding with other amino acids. Thus, H-Gly-OBzl p-Tosylate is a useful reactant in biochemistry and medicinal chemistry research.
Check Digit Verification of cas no
The CAS Registry Mumber 114342-15-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,4,3,4 and 2 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 114342-15:
(8*1)+(7*1)+(6*4)+(5*3)+(4*4)+(3*2)+(2*1)+(1*5)=83
83 % 10 = 3
So 114342-15-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H11NO2.C7H8O3S/c10-6-9(11)12-7-8-4-2-1-3-5-8;1-6-2-4-7(5-3-6)11(8,9)10/h1-5H,6-7,10H2;2-5H,1H3,(H,8,9,10)