1148-63-6 Usage
Uses
Used in Molecular Biology Research:
THYMINE, [METHYL-3H] is used as a radioactive tracer for studying the synthesis, repair, and replication of DNA and RNA. The tritium label enables researchers to monitor the incorporation of thymidine into nucleic acids, providing valuable insights into the mechanisms of genetic information transfer and cellular processes.
Used in Cancer Research:
In cancer research, THYMINE, [METHYL-3H] can be employed as a tool to investigate the rate of DNA synthesis in cancer cells, which often exhibit increased proliferation compared to normal cells. This information can be crucial for understanding the underlying molecular mechanisms of cancer and for the development of targeted therapies.
Used in Radioimmunoassays:
THYMINE, [METHYL-3H] can be utilized in radioimmunoassays, a technique that involves the use of radioactive isotopes to measure the concentration of specific molecules in a sample. This application can be particularly useful in the detection and quantification of nucleic acids or their metabolites in various biological samples.
Used in Pharmaceutical Development:
The compound can also be used in the development of new drugs targeting nucleic acid metabolism or DNA repair mechanisms. By studying the interaction of THYMINE, [METHYL-3H] with potential drug candidates, researchers can gain a better understanding of the molecular interactions involved and optimize the drug design for improved efficacy and safety.
Check Digit Verification of cas no
The CAS Registry Mumber 1148-63-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,1,4 and 8 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 1148-63:
(6*1)+(5*1)+(4*4)+(3*8)+(2*6)+(1*3)=66
66 % 10 = 6
So 1148-63-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H14N2O5/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,16)/t6-,7+,8+/m0/s1/i1T
