114991-69-4 Usage
General Description
3-Methoxy-4-(3-methylbutoxy)benzaldehyde is a chemical compound with the molecular formula C12H16O3. It is an aromatic aldehyde with a methoxy group and a 3-methylbutoxy group attached to a benzene ring, giving it a unique and complex structure. 3-methoxy-4-(3-methylbutoxy)benzaldehyde is commonly used in the synthesis of pharmaceuticals, agrochemicals, and fragrances due to its aldehyde functional group, which can react with other compounds to form various types of chemical products. Additionally, it has potential applications in organic synthesis and may act as a building block for the creation of novel molecules with specific properties. Overall, 3-Methoxy-4-(3-methylbutoxy)benzaldehyde is a versatile and important chemical with diverse applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 114991-69-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,4,9,9 and 1 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 114991-69:
(8*1)+(7*1)+(6*4)+(5*9)+(4*9)+(3*1)+(2*6)+(1*9)=144
144 % 10 = 4
So 114991-69-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H18O3/c1-10(2)6-7-16-12-5-4-11(9-14)8-13(12)15-3/h4-5,8-10H,6-7H2,1-3H3
