115-56-0 Usage
Uses
Used in Pharmaceutical Research:
5-Ethyldihydro-5-(2-methylallyl)-2-thioxo-1H,5H-pyrimidine-4,6-dione is used as a research compound for its potential therapeutic properties. Its unique structure and functional groups make it a valuable target for the development of new drugs and treatments.
Used in Drug Development:
In the pharmaceutical industry, 5-ethyldihydro-5-(2-methylallyl)-2-thioxo-1H,5H-pyrimidine-4,6-dione is used as a lead compound for the design and synthesis of novel therapeutic agents. Its complex molecular structure and functional groups offer opportunities for further modification and optimization to enhance its pharmacological properties and therapeutic efficacy.
Check Digit Verification of cas no
The CAS Registry Mumber 115-56-0 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,1 and 5 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 115-56:
(5*1)+(4*1)+(3*5)+(2*5)+(1*6)=40
40 % 10 = 0
So 115-56-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H14N2O2S/c1-4-10(5-6(2)3)7(13)11-9(15)12-8(10)14/h2,4-5H2,1,3H3,(H2,11,12,13,14,15)
