115044-37-6 Usage
General Description
1,3-bis(4-amidinophenoxy)-2-(4-amidinophenoxymethyl)ethylpropane, also known as bis-aminophenoxyethyl propane, is a synthetic organic compound with potential antithrombotic properties. It belongs to a class of chemicals called amidinophenoxides, which are known for their ability to inhibit the formation of blood clots. This specific chemical has two amidinophenoxy groups, which are connected by a three-carbon chain. It is thought to inhibit the formation of blood clots by blocking the activity of certain proteins involved in the blood coagulation process. Although further research is needed to fully understand its potential therapeutic applications, it is being investigated for its potential use as an anticoagulant or antiplatelet agent.
Check Digit Verification of cas no
The CAS Registry Mumber 115044-37-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,5,0,4 and 4 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 115044-37:
(8*1)+(7*1)+(6*5)+(5*0)+(4*4)+(3*4)+(2*3)+(1*7)=86
86 % 10 = 6
So 115044-37-6 is a valid CAS Registry Number.
InChI:InChI=1/C27H32N6O3/c1-2-24(36-23-13-7-19(8-14-23)27(32)33)20(15-34-21-9-3-17(4-10-21)25(28)29)16-35-22-11-5-18(6-12-22)26(30)31/h3-14,20,24H,2,15-16H2,1H3,(H3,28,29)(H3,30,31)(H3,32,33)