115088-47-6 Usage
General Description
Bacillomycin Fc is a cyclic lipopeptide antibiotic produced by bacteria of the Bacillus subtilis group. It is known for its strong antifungal and antibacterial properties, making it a potential candidate for use in agricultural and medical applications. Bacillomycin Fc works by disrupting the cell membranes of target organisms, leading to their death. Its ability to effectively control a broad range of fungal and bacterial pathogens makes it a valuable tool for crop protection and disease management. Additionally, its low toxicity to humans and the environment further enhance its potential as a sustainable and eco-friendly alternative to conventional chemical pesticides and antimicrobial agents.
Check Digit Verification of cas no
The CAS Registry Mumber 115088-47-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,5,0,8 and 8 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 115088-47:
(8*1)+(7*1)+(6*5)+(5*0)+(4*8)+(3*8)+(2*4)+(1*7)=116
116 % 10 = 6
So 115088-47-6 is a valid CAS Registry Number.
InChI:InChI=1/C52H84N12O14/c1-4-30(2)15-11-9-7-5-6-8-10-12-16-33-26-45(72)60-37(27-41(54)68)49(75)62-36(25-32-18-20-34(66)21-19-32)48(74)63-39(29-43(56)70)50(76)61-35(22-23-40(53)67)47(73)57-24-14-13-17-44(71)59-38(28-42(55)69)51(77)64-46(31(3)65)52(78)58-33/h18-21,30-31,33,35-39,46,65-66H,4-17,22-29H2,1-3H3,(H2,53,67)(H2,54,68)(H2,55,69)(H2,56,70)(H,57,73)(H,58,78)(H,59,71)(H,60,72)(H,61,76)(H,62,75)(H,63,74)(H,64,77)