115102-47-1 Usage
Uses
Used in Pharmaceutical Synthesis:
5-Ethoxy-furan-2-carboxylic acid is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure and functional groups contribute to the development of new drugs with improved efficacy and safety profiles.
Used in Organic Chemistry:
As a building block in organic chemistry, 5-Ethoxy-furan-2-carboxylic acid is utilized in the creation of complex organic molecules and compounds. Its reactivity allows for a wide range of chemical reactions, facilitating the synthesis of diverse organic compounds for various applications.
Used in Medicinal Chemistry Research:
5-Ethoxy-furan-2-carboxylic acid is employed in medicinal chemistry research as a potential drug intermediate or active ingredient. Its unique properties and reactivity make it a valuable component in the development of new treatments for various diseases and conditions.
Used in Drug Development:
In the pharmaceutical industry, 5-Ethoxy-furan-2-carboxylic acid is used as a starting material for the development of new drugs. Its versatility in chemical reactions enables the creation of novel drug candidates with potential therapeutic benefits.
Overall, 5-Ethoxy-furan-2-carboxylic acid holds significant value in the fields of pharmaceuticals and organic chemistry due to its unique structure, reactivity, and potential for diverse applications in drug synthesis, organic compound creation, and medicinal chemistry research.
Check Digit Verification of cas no
The CAS Registry Mumber 115102-47-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,5,1,0 and 2 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 115102-47:
(8*1)+(7*1)+(6*5)+(5*1)+(4*0)+(3*2)+(2*4)+(1*7)=71
71 % 10 = 1
So 115102-47-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H8O4/c1-2-10-6-4-3-5(11-6)7(8)9/h3-4H,2H2,1H3,(H,8,9)/p-1
