115416-34-7 Usage
General Description
The chemical "(((amino-2-ethyl)-2-aminomethyl)-2-pyridine-6-carboxylhistidyl-gamma-(2-amino-2-deoxyglucosyl)glutamylglycylamino)-4-phenyl-1-aminoacridine" is a complex compound with a long molecular structure. It contains various amino acids and sugars, as well as an acridine group. The compound has potential biological activity due to its amino acid and sugar components, as well as the presence of the acridine group, which is known for its DNA intercalating properties. The compound's specific chemical structure and properties make it an interesting candidate for further research in the fields of medicine and biochemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 115416-34-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,5,4,1 and 6 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 115416-34:
(8*1)+(7*1)+(6*5)+(5*4)+(4*1)+(3*6)+(2*3)+(1*4)=97
97 % 10 = 7
So 115416-34-7 is a valid CAS Registry Number.
InChI:InChI=1/C46H54N12O9/c47-18-19-48-21-29-6-5-11-39(52-29)56-36(20-30-22-49-26-51-30)46(67)58-35(16-17-40(62)57-37(24-59)43(64)44(65)38(61)25-60)45(66)50-23-41(63)53-27-12-14-28(15-13-27)54-42-31-7-1-3-9-33(31)55-34-10-4-2-8-32(34)42/h1-15,22,24,26,35-38,43-44,48,60-61,64-65H,16-21,23,25,47H2,(H,49,51)(H,50,66)(H,52,56)(H,53,63)(H,54,55)(H,57,62)(H,58,67)