115617-41-9 Usage
Uses
Used in Pharmaceutical Industry:
4,5-Dichloro-6-ethylpyrimidine is used as a synthetic intermediate for the development of various pharmaceutical compounds. Its unique structure allows it to be a key component in the creation of new drugs, particularly those targeting specific biological pathways or receptors.
Used in Chemical Research:
4,5-Dichloro-6-ethylpyrimidine is used as a research compound in academic and industrial laboratories. It serves as a model compound for studying the properties and reactions of pyrimidine derivatives, contributing to the advancement of organic chemistry and related fields.
Used in Agrochemical Industry:
4,5-Dichloro-6-ethylpyrimidine is used as a precursor in the synthesis of agrochemicals, such as pesticides and herbicides. Its reactivity and structural features make it a valuable component in the development of new and effective products for agricultural use.
Used in Material Science:
4,5-Dichloro-6-ethylpyrimidine is used as a building block in the synthesis of advanced materials, such as polymers and composites. Its incorporation into these materials can impart unique properties, such as improved stability or enhanced functionality, making it a valuable asset in material science research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 115617-41-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,5,6,1 and 7 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 115617-41:
(8*1)+(7*1)+(6*5)+(5*6)+(4*1)+(3*7)+(2*4)+(1*1)=109
109 % 10 = 9
So 115617-41-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H6Cl2N2/c1-2-4-5(7)6(8)10-3-9-4/h3H,2H2,1H3
