116008-52-7 Usage
Uses
Used in Pharmaceutical Industry:
1H-Pyrazole-3-carboxylic acid, 4-aminois used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with diverse therapeutic applications, including the treatment of various diseases and disorders.
Used in Agrochemical Industry:
In the agrochemical industry, 1H-Pyrazole-3-carboxylic acid, 4-aminois utilized as a building block for the synthesis of agrochemicals, such as pesticides and herbicides. Its incorporation into these compounds can enhance their effectiveness in controlling pests and weeds, thereby improving crop yields and quality.
Used in Drug Discovery and Development:
Due to its potential biological activity, 1H-Pyrazole-3-carboxylic acid, 4-aminois employed in drug discovery and development processes. Researchers can use 1H-Pyrazole-3-carboxylicacid,4-amino- to design and synthesize new drug candidates with novel mechanisms of action, potentially leading to the development of more effective treatments for various diseases.
Used in Organic Synthesis:
As a versatile building block, 1H-Pyrazole-3-carboxylic acid, 4-aminois widely used in organic synthesis for the preparation of various organic compounds. Its reactivity and functional groups enable the formation of diverse chemical structures, which can be further utilized in various applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 116008-52-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,6,0,0 and 8 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 116008-52:
(8*1)+(7*1)+(6*6)+(5*0)+(4*0)+(3*8)+(2*5)+(1*2)=87
87 % 10 = 7
So 116008-52-7 is a valid CAS Registry Number.
InChI:InChI=1/C4H5N3O2/c5-2-1-6-7-3(2)4(8)9/h1H,5H2,(H,6,7)(H,8,9)
