116081-20-0 Usage
General Description
1,2-Dihydro-4-hydroxy-6-methyl-3H-pyrazolo[3,4-b]pyridin-3-one is a chemical compound with a complex molecular structure. It is a heterocyclic compound that contains a pyrazolo and pyridinone ring system. 1,2-Dihydro-4-hydroxy-6-methyl-3H-pyrazolo[3,4-b]pyridin-3-one has a hydroxy group and a methyl group attached to the pyrazole ring. It is a yellow solid that is soluble in organic solvents. 1,2-Dihydro-4-hydroxy-6-methyl-3H-pyrazolo[3,4-b]pyridin-3-one is used in research and pharmaceutical applications for its potential therapeutic properties. Additionally, it can serve as a building block for the synthesis of more complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 116081-20-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,6,0,8 and 1 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 116081-20:
(8*1)+(7*1)+(6*6)+(5*0)+(4*8)+(3*1)+(2*2)+(1*0)=90
90 % 10 = 0
So 116081-20-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H7N3O2/c1-3-2-4(11)5-6(8-3)9-10-7(5)12/h2H,1H3,(H3,8,9,10,11,12)