116171-01-8 Usage
General Description
5-ACETYL-4-AMINO-2-(METHYLTHIO)THIOPHENE-3-CARBONITRILE is a chemical compound with the molecular formula C10H9N3OS2. It is a thiophene derivative that contains an acetyl group, an amino group, a methylthio group, and a carbonitrile functional group. 5-ACETYL-4-AMINO-2-(METHYLTHIO)THIOPHENE-3-CARBONITRILE has potential applications in the field of organic synthesis and pharmaceuticals due to its unique structure and properties. It may be used as a building block in the synthesis of various organic molecules and may also exhibit biological activity, making it a target for drug discovery and development. Additionally, its diverse functional groups offer opportunities for the development of new materials and chemical reactions.
Note: If you are looking for information on a specific chemical compound, please provide its name or CAS number for a more accurate and detailed summary.
Check Digit Verification of cas no
The CAS Registry Mumber 116171-01-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,6,1,7 and 1 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 116171-01:
(8*1)+(7*1)+(6*6)+(5*1)+(4*7)+(3*1)+(2*0)+(1*1)=88
88 % 10 = 8
So 116171-01-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N2OS2/c1-4(11)7-6(10)5(3-9)8(12-2)13-7/h10H2,1-2H3
