116292-10-5 Usage
General Description
Norleucine, 5-amino-6-fluoro-(9CI) is a fluorinated amino acid that is structurally similar to the naturally occurring amino acid norleucine, also known as 2-amino-4-methylpentanoic acid. It contains a fluorine atom at the 6th position, which imparts unique chemical properties to the compound. Norleucine, 5-amino-6-fluoro-(9CI) is primarily used in research and pharmaceutical applications, where its fluorinated structure can be utilized for various purposes, such as protein modification, drug development, and biochemical studies. Its incorporation into peptides and proteins can also provide valuable insights into their structural and functional properties. Overall, Norleucine, 5-amino-6-fluoro-(9CI) is a valuable chemical compound with potential applications in a wide range of scientific and medical fields.
Check Digit Verification of cas no
The CAS Registry Mumber 116292-10-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,6,2,9 and 2 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 116292-10:
(8*1)+(7*1)+(6*6)+(5*2)+(4*9)+(3*2)+(2*1)+(1*0)=105
105 % 10 = 5
So 116292-10-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H13FN2O2/c7-3-4(8)1-2-5(9)6(10)11/h4-5H,1-3,8-9H2,(H,10,11)
