116409-73-5 Usage
General Description
15-(3,4-Dichlorophenyl)pentadecanoic acid is a chemical compound that belongs to the class of organic compounds known as fatty acids and conjugates. It is specifically classified as a long-chain fatty acid and contains a 15-carbon backbone, along with a terminal carboxylic acid group. The presence of the 3,4-dichlorophenyl functional group on the molecule is responsible for its unique properties and potential applications. 15-(3,4-DICHLOROPHENYL)PENTADECANOIC ACID may have various industrial and pharmaceutical applications, including its potential use as a building block for the synthesis of other organic compounds or as a pharmacological agent. However, further research is needed to fully understand its characteristics and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 116409-73-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,6,4,0 and 9 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 116409-73:
(8*1)+(7*1)+(6*6)+(5*4)+(4*0)+(3*9)+(2*7)+(1*3)=115
115 % 10 = 5
So 116409-73-5 is a valid CAS Registry Number.
InChI:InChI=1/C21H32Cl2O2/c22-19-16-15-18(17-20(19)23)13-11-9-7-5-3-1-2-4-6-8-10-12-14-21(24)25/h15-17H,1-14H2,(H,24,25)