116568-17-3 Usage
Description
1H-Benzimidazole-5-carboxamide is a chemical compound that combines the properties of both benzimidazole and carboxamide groups. The benzimidazole part of this compound features a bicyclic structure with fused benzene and imidazole rings, which is known for its pharmacological properties and is commonly found in various medical drugs. The carboxamide group, an amide derived from a carboxylic acid, plays a significant role in biochemistry and drug design. Due to its potential biological activities, 1H-Benzimidazole-5-carboxamide is primarily used in scientific research, particularly for the development and design of pharmaceutical drugs.
Uses
Used in Pharmaceutical Research and Development:
1H-Benzimidazole-5-carboxamide is used as a key component in the development of pharmaceutical drugs for its potential biological activities. 1H-BENZIMIDAZOLE-5-CARBOXAMIDE's unique structure and properties make it a valuable asset in creating new medications with specific therapeutic effects.
Used in Drug Design:
1H-Benzimidazole-5-carboxamide is utilized as a building block in drug design, where its benzimidazole and carboxamide groups contribute to the compound's overall pharmacological profile. This allows researchers to create drugs with tailored properties, such as improved efficacy, selectivity, and reduced side effects.
Safety and Handling:
The safety and handling requirements for 1H-Benzimidazole-5-carboxamide depend on the specific nature of the compound, including any additional functional groups it may contain. Proper precautions should be taken during its synthesis, storage, and use to ensure the safety of researchers and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 116568-17-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,6,5,6 and 8 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 116568-17:
(8*1)+(7*1)+(6*6)+(5*5)+(4*6)+(3*8)+(2*1)+(1*7)=133
133 % 10 = 3
So 116568-17-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H7N3O/c9-8(12)5-1-2-6-7(3-5)11-4-10-6/h1-4H,(H2,9,12)(H,10,11)
