116702-65-9 Usage
Uses
Used in Pharmaceutical Industry:
3-Amino-2-(4-methylphenylamino)benzoic acid is used as a building block in the synthesis of pharmaceuticals for its potential to contribute to the development of new drugs. Its unique chemical structure allows for the creation of various medicinal compounds.
Used in Dye Industry:
In the dye industry, 3-Amino-2-(4-methylphenylamino)benzoic acid is utilized as a building block for the synthesis of dyes, taking advantage of its chemical properties to produce a range of colorants for different applications.
Used in Chemical Research:
3-Amino-2-(4-methylphenylamino)benzoic acid serves as a reagent in chemical research, where it aids in various experimental procedures and the exploration of new chemical reactions and processes.
Used in Organic Material Production:
3-Amino-2-(4-methylphenylamino)benzoic acid is also used in the production of organic materials, where its specific properties can enhance the characteristics of the final products, such as their stability or reactivity.
Used in Biological Research:
3-Amino-2-(4-methylphenylamino)benzoic acid is the subject of ongoing research for its potential biological activity. Scientists are investigating its possible pharmacological properties, which could lead to its use in the development of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 116702-65-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,6,7,0 and 2 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 116702-65:
(8*1)+(7*1)+(6*6)+(5*7)+(4*0)+(3*2)+(2*6)+(1*5)=109
109 % 10 = 9
So 116702-65-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H14N2O2/c1-9-5-7-10(8-6-9)16-13-11(14(17)18)3-2-4-12(13)15/h2-8,16H,15H2,1H3,(H,17,18)
