116753-49-2 Usage
Uses
Used in Pharmaceutical Industry:
3-(3-fluorophenoxy)propan-1-amine is used as a synthetic intermediate for the development of pharmaceutical compounds. Its unique structure allows it to be a key component in the creation of new drugs, potentially contributing to advancements in medicinal chemistry.
Used in Research Applications:
In the realm of scientific research, 3-(3-fluorophenoxy)propan-1-amine serves as a valuable building block for the synthesis of complex organic molecules. It is instrumental in exploring novel chemical reactions and the discovery of new chemical entities with potential applications in various fields.
Used in Organic Synthesis:
3-(3-fluorophenoxy)propan-1-amine is employed as a reagent in organic synthesis processes. Its presence can influence the outcome of reactions, enabling the production of a wide array of organic compounds for diverse applications, including but not limited to materials science, agrochemicals, and specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 116753-49-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,6,7,5 and 3 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 116753-49:
(8*1)+(7*1)+(6*6)+(5*7)+(4*5)+(3*3)+(2*4)+(1*9)=132
132 % 10 = 2
So 116753-49-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H12FNO/c10-8-3-1-4-9(7-8)12-6-2-5-11/h1,3-4,7H,2,5-6,11H2
