117-97-5 Usage
Description
Pentachlorobenzenethiol zinc salt is a versatile chemical compound consisting of a zinc ion complexed with pentachlorobenzenethiol. It is known for its catalytic properties in organic synthesis reactions, particularly in the formation of carbon-carbon and carbon-sulfur bonds. PENTACHLOROBENZENETHIOL ZINC SALT also exhibits potential in biological applications, such as an anti-corrosion agent and a potential treatment for certain types of cancer. Furthermore, it has been studied for its potential use in the development of new materials and in the field of nanotechnology.
Uses
Used in Organic Synthesis:
Pentachlorobenzenethiol zinc salt is used as a catalyst in organic synthesis for its ability to facilitate the formation of carbon-carbon and carbon-sulfur bonds. This enhances the efficiency and selectivity of various chemical reactions, making it a valuable tool in the synthesis of complex organic molecules.
Used in Anti-corrosion Applications:
In the anti-corrosion industry, pentachlorobenzenethiol zinc salt is used as a protective agent to prevent the corrosion of metals. Its chemical properties make it effective in inhibiting the oxidation and degradation of metal surfaces, thereby extending the lifespan of metal components and structures.
Used in Cancer Treatment Research:
Pentachlorobenzenethiol zinc salt is being studied for its potential as a treatment for certain types of cancer. Its unique chemical structure allows it to interact with biological systems in ways that may inhibit cancer cell growth and proliferation, offering a new avenue for cancer therapy development.
Used in Material Science and Nanotechnology:
In the fields of material science and nanotechnology, pentachlorobenzenethiol zinc salt is used as a component in the development of new materials with unique properties. Its incorporation into nanostructures and other materials can lead to advancements in areas such as electronics, energy storage, and biomedical applications.
Overall, pentachlorobenzenethiol zinc salt is a multifaceted compound with applications spanning across various scientific and industrial domains, making it a valuable asset in the pursuit of innovative solutions and advancements.
Check Digit Verification of cas no
The CAS Registry Mumber 117-97-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,1 and 7 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 117-97:
(5*1)+(4*1)+(3*7)+(2*9)+(1*7)=55
55 % 10 = 5
So 117-97-5 is a valid CAS Registry Number.
InChI:InChI=1/C6HCl5S.Zn/c7-1-2(8)4(10)6(12)5(11)3(1)9;/h12H;/q;+2