1170-79-2 Usage
General Description
The chemical "1-[(4-chlorophenyl)methylsulfanyl]-N-[2-[(4-chlorophenyl)methylsulfanylcarbothioylamino]ethyl]methanethioamide" is a compound with a complex molecular structure. It contains a benzene ring with a chlorine atom attached to it, as well as a sulfur atom. The compound also includes a carbothioylamino group and an ethyl group. Overall, the chemical consists of various functional groups such as sulfonyl, thioamide, and carbothioylamino, making it potentially useful in various applications in chemistry and pharmaceutical research.
Check Digit Verification of cas no
The CAS Registry Mumber 1170-79-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,1,7 and 0 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1170-79:
(6*1)+(5*1)+(4*7)+(3*0)+(2*7)+(1*9)=62
62 % 10 = 2
So 1170-79-2 is a valid CAS Registry Number.
InChI:InChI=1/C18H18Cl2N2S4/c19-15-5-1-13(2-6-15)11-25-17(23)21-9-10-22-18(24)26-12-14-3-7-16(20)8-4-14/h1-8H,9-12H2,(H,21,23)(H,22,24)