117068-07-2 Usage
Uses
Used in Pharmaceutical Industry:
2-(DIMETHYLAMINO)-2-(1-METHYL-1H-PYRROL-2-YL)ACETONITRILE is used as a building block for the preparation of various pharmaceuticals due to its potential in the development of new drugs targeting the central nervous system. Its structural features contribute to the creation of compounds with specific therapeutic effects.
Used in Agrochemical Industry:
In the agrochemical sector, 2-(DIMETHYLAMINO)-2-(1-METHYL-1H-PYRROL-2-YL)ACETONITRILE serves as a key intermediate in the synthesis of agrochemicals, aiding in the development of effective products for agricultural applications.
Used in Medicinal Chemistry Research:
2-(DIMETHYLAMINO)-2-(1-METHYL-1H-PYRROL-2-YL)ACETONITRILE is utilized as a research compound in medicinal chemistry, where it is explored for its potential to contribute to the discovery and design of novel drug candidates with improved pharmacological properties.
Organic Synthesis:
2-(DIMETHYLAMINO)-2-(1-METHYL-1H-PYRROL-2-YL)ACETONITRILE is used as an intermediate in organic synthesis for the production of diverse organic compounds, leveraging its unique chemical properties to facilitate the creation of new chemical entities with various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 117068-07-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,7,0,6 and 8 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 117068-07:
(8*1)+(7*1)+(6*7)+(5*0)+(4*6)+(3*8)+(2*0)+(1*7)=112
112 % 10 = 2
So 117068-07-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H13N3/c1-11(2)9(7-10)8-5-4-6-12(8)3/h4-6,9H,1-3H3/p+1/t9-/m0/s1
