117346-20-0 Usage
Molecular structure
A bioactive lipid molecule derived from the metabolism of arachidonic acid
Enzyme involved in its production
12-lipoxygenase
Occurrence
Often found in inflammatory processes and cellular signaling pathways
Implications
Involved in various physiological and pathological processes, including inflammation, angiogenesis, and cancer progression
Mechanism of action
Binds to specific receptors and activates downstream signaling pathways, leading to the regulation of gene expression and cellular responses
Properties
Pro-inflammatory and pro-angiogenic
Therapeutic interest
Target for therapeutic intervention in conditions such as inflammation and cancer
Check Digit Verification of cas no
The CAS Registry Mumber 117346-20-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,7,3,4 and 6 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 117346-20:
(8*1)+(7*1)+(6*7)+(5*3)+(4*4)+(3*6)+(2*2)+(1*0)=110
110 % 10 = 0
So 117346-20-0 is a valid CAS Registry Number.
InChI:InChI=1/C20H34O3/c1-2-3-4-5-10-13-16-19(21)17-14-11-8-6-7-9-12-15-18-20(22)23/h7-11,13,19,21H,2-6,12,14-18H2,1H3,(H,22,23)/b9-7-,11-8-,13-10-/t19-/m0/s1
