117500-61-5 Usage
General Description
3-Dimethylaminobenzoyl chloride hydrochloride is a chemical compound used in the synthesis of various pharmaceuticals and organic compounds. It is a derivative of benzoic acid and contains a benzoyl chloride functional group, making it reactive and suitable for use in chemical reactions. 3-DIMETHYLAMINOBENZOYL CHLORIDE HYDROCHLORIDE is often employed as a reagent in the preparation of amides, esters, and other organic compounds. It is also used as a key intermediate in the production of certain drugs and dyes. 3-Dimethylaminobenzoyl chloride hydrochloride is a versatile chemical that plays a crucial role in the synthesis of many valuable products.
Check Digit Verification of cas no
The CAS Registry Mumber 117500-61-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,7,5,0 and 0 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 117500-61:
(8*1)+(7*1)+(6*7)+(5*5)+(4*0)+(3*0)+(2*6)+(1*1)=95
95 % 10 = 5
So 117500-61-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H10ClNO.ClH/c1-11(2)8-5-3-4-7(6-8)9(10)12;/h3-6H,1-2H3;1H
117500-61-5Relevant articles and documents
Substituted anilino-quinazoline (or quinoline) compounds and use thereof
-
, (2008/06/13)
The invention concerns amide derivatives of Formula (I), wherein: G is N or CH; R1is a group such as hydroxy, halo, trifluoromethyl, C1-6alkyl and C1-6alkoxy; each of R2and R3is hydrogen, halo, C1-6alkyl, C2-6alkenyl or C2-6alkynyl; R4is a group such as hydrogen, hydroxy, C1-6alkyl, C1-6alkoxy and C3-7cycloalkyl, or R4is of the Formula (IC): —K—J, wherein J is aryl, heteroaryl or heterocyclyl and K is a bond or a group such as oxy and imino, R5is a group such as hydrogen, halo and trifluoromethyl: m is 1-3 and q is 0-4; or pharmaceutically acceptable salts or in vivo cleavable esters thereof; processes for their preparation, pharmaceutical compositions containing them and their use in the treatment of diseases or medical conditions mediated by cytokines.
