117694-77-6 Usage
Chemical classification
Azacycle A cyclic compound containing nitrogen.
Enzyme inhibition
Farnesyltransferase An enzyme involved in cancer cell growth and proliferation.
Potential use
Cancer treatment Particularly targeting Ras proteins associated with various types of cancer.
Anti-inflammatory properties
May have potential applications in treating diseases and conditions related to inflammation.
Research and development
Interesting target for further research and development in the field of medicinal chemistry due to its unique structure and biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 117694-77-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,7,6,9 and 4 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 117694-77:
(8*1)+(7*1)+(6*7)+(5*6)+(4*9)+(3*4)+(2*7)+(1*7)=156
156 % 10 = 6
So 117694-77-6 is a valid CAS Registry Number.
InChI:InChI=1/C21H35NO/c1-18(2)10-8-11-19(3)12-9-13-20(4)15-17-22-16-7-5-6-14-21(22)23/h10,12,15H,5-9,11,13-14,16-17H2,1-4H3/b19-12+,20-15+