117773-99-6 Usage
General Description
(1,2-bis(2,6-dichloro-4-hydroxyphenyl)ethylenediamine)dichloroplatinum (II) is a chemical compound containing platinum. It is a coordination complex with two chloride ions and the ligand 1,2-bis(2,6-dichloro-4-hydroxyphenyl)ethylenediamine. (1,2-bis(2,6-dichloro-4-hydroxyphenyl)ethylenediamine)dichloroplatinum (II) has potential applications in chemotherapy as a platinum-based anticancer drug. Platinum compounds are widely used in cancer treatment due to their ability to bind to DNA and interfere with its replication and transcription, ultimately leading to cell death. However, the specific properties and potential uses of (1,2-bis(2,6-dichloro-4-hydroxyphenyl)ethylenediamine)dichloroplatinum (II) would need to be further studied and evaluated for its efficacy and safety.
Check Digit Verification of cas no
The CAS Registry Mumber 117773-99-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,7,7,7 and 3 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 117773-99:
(8*1)+(7*1)+(6*7)+(5*7)+(4*7)+(3*3)+(2*9)+(1*9)=156
156 % 10 = 6
So 117773-99-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H12Cl4N2O2.2ClH.Pt/c15-7-1-5(21)2-8(16)11(7)13(19)14(20)12-9(17)3-6(22)4-10(12)18;;;/h1-4,13-14,21-22H,19-20H2;2*1H;/q;;;+2/p-2
