117923-19-0 Usage
Uses
Used in Chemical Synthesis:
1,2-difluoro-4-(4-(2-(4-ethylcyclohexyl)ethyl)cyclohexyl)benzene is used as a building block in the synthesis of other organic compounds, leveraging its complex structure to create novel molecules with specific properties.
Used in Polymer Production:
In the polymer industry, 1,2-difluoro-4-(4-(2-(4-ethylcyclohexyl)ethyl)cyclohexyl)benzene is used as a monomer or a component in the production of specialized polymers. Its unique molecular structure contributes to the development of polymers with tailored characteristics for various applications.
Used in Pharmaceutical Industry:
1,2-difluoro-4-(4-(2-(4-ethylcyclohexyl)ethyl)cyclohexyl)benzene may be utilized as an intermediate in the pharmaceutical sector for the development of new drugs, given its potential to form complex molecular frameworks that could interact with biological targets.
Used in Material Science:
In material science, 1,2-difluoro-4-(4-(2-(4-ethylcyclohexyl)ethyl)cyclohexyl)benzene is used to engineer materials with specific properties, such as high thermal stability or unique electronic characteristics, by incorporating its structure into the material's composition.
Check Digit Verification of cas no
The CAS Registry Mumber 117923-19-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,7,9,2 and 3 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 117923-19:
(8*1)+(7*1)+(6*7)+(5*9)+(4*2)+(3*3)+(2*1)+(1*9)=130
130 % 10 = 0
So 117923-19-0 is a valid CAS Registry Number.
InChI:InChI=1/C22H32F2/c1-2-16-3-5-17(6-4-16)7-8-18-9-11-19(12-10-18)20-13-14-21(23)22(24)15-20/h13-19H,2-12H2,1H3