118-04-7 Usage
Description
2-(3-Amino-4-chloro-benzoyl)benzoic acid is a synthetic intermediate with a unique chemical structure that features an amino group, a chloro substituent, and a benzoyl group attached to a benzoic acid backbone. 2-(3-Amino-4-chloro-benzoyl)benzoic acid plays a significant role in the synthesis of various biologically active molecules and has potential applications in the pharmaceutical and chemical industries.
Uses
Used in Pharmaceutical Industry:
2-(3-Amino-4-chloro-benzoyl)benzoic acid is used as a synthetic intermediate for the preparation of protein kinase C phosphorylates, which are essential in the development of drugs targeting protein kinases. These kinases play a crucial role in various cellular processes, including cell growth, differentiation, and apoptosis, making them attractive targets for therapeutic intervention in various diseases, such as cancer and inflammatory disorders.
Used in Chemical Research:
2-(3-Amino-4-chloro-benzoyl)benzoic acid is also used as a synthetic intermediate in the preparation of synthetic fluorescent reporters. These reporters are valuable tools in chemical and biological research, as they allow for the visualization and tracking of specific molecules or cellular processes. The unique structure of 2-(3-Amino-4-chloro-benzoyl)benzoic acid enables the development of fluorescent reporters with specific properties, such as emission wavelengths, quantum yields, and photostability, which can be tailored to the needs of various research applications.
Check Digit Verification of cas no
The CAS Registry Mumber 118-04-7 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,1 and 8 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 118-04:
(5*1)+(4*1)+(3*8)+(2*0)+(1*4)=37
37 % 10 = 7
So 118-04-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H10ClNO3/c15-11-6-5-8(7-12(11)16)13(17)9-3-1-2-4-10(9)14(18)19/h1-7H,16H2,(H,18,19)/p-1
118-04-7Relevant articles and documents
Synthesis method of chlorthalidone medicine intermediate 2-(3-amino-4-chlorobenzoyl)benzoic acid
-
Paragraph 0019; 0020; 0021; 0022; 0023, (2016/12/01)
The invention discloses a synthesis method of a chlorthalidone medicine intermediate 2-(3-amino-4-chlorobenzoyl)benzoic acid. The method comprises the following steps: reacting 2-(3-nitro-4-chlorobenzoyl)benzoic acid with cuprous chloride and potassium iodide, washing the obtained reaction product, carrying out suction pumping, and dehydrating the reaction product to obtain 2-(3-amino-4-chlorobenzoyl)benzoic acid. The whole reaction time is controlled to be 8h or shorter, and the reaction yield can reach 90% or above. The method provides a new synthesis route, and lays a good foundation for further increase of the reaction yield.
Transfer catalysis between two solids: Application to the reduction of nitroarenes
Hari, Anitha,Miller, Benjamin L.
, p. 2777 - 2779 (2007/10/03)
A wide range of aromatic nitro compounds can be reduced to anilines through the use of a Cr(II)/Mn0 redox couple in the presence of trimethylsilyl chloride [TMSCl, Eq. (1)]. Only 0.25 equivalents of chromium are required to reduce solid-supported nitroarenes (R = solid support); this represents a rare case of transfer catalysis between two solid phases. The reaction is also amenable to solution-phase synthesis (R = OH).
