118054-54-9 Usage
General Description
(1-Methyl-1H-imidazol-2-yl)-acetic acid, also known as histidine, is an organic compound that is a derivative of the amino acid histidine. It plays a crucial role in the biosynthesis of proteins and is involved in various biochemical processes in the body. It is also a precursor to histamine, a neurotransmitter that plays a role in the immune response and allergic reactions. Additionally, (1-Methyl-1H-imidazol-2-yl)-acetic acid has been studied for its potential therapeutic applications in the treatment of various conditions, including inflammation, cardiovascular diseases, and central nervous system disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 118054-54-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,8,0,5 and 4 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 118054-54:
(8*1)+(7*1)+(6*8)+(5*0)+(4*5)+(3*4)+(2*5)+(1*4)=109
109 % 10 = 9
So 118054-54-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N2O2/c1-8-3-2-7-5(8)4-6(9)10/h2-3H,4H2,1H3,(H,9,10)