118469-08-2 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
1H-Benzimidazole-2-carboxaldehyde,1-(fluoromethyl)-(9CI) is used as a reagent and intermediate for the synthesis of various pharmaceuticals and agrochemicals. Its unique structure and fluoromethyl group contribute to the development of new and improved compounds with enhanced properties and efficacy.
Used in Drug Discovery and Development:
As a building block for the preparation of fluorinated compounds, 1H-Benzimidazole-2-carboxaldehyde,1-(fluoromethyl)-(9CI) is utilized in drug discovery and development. The incorporation of fluorine atoms into drug molecules can significantly influence their pharmacokinetic and pharmacodynamic properties, leading to improved therapeutic outcomes.
Used in Material Science:
Due to its unique structural features, 1H-Benzimidazole-2-carboxaldehyde,1-(fluoromethyl)-(9CI) may have potential applications in material science. Its properties can be harnessed to develop new materials with specific characteristics, such as enhanced stability, reactivity, or selectivity.
Used in Medicinal Chemistry:
1H-Benzimidazole-2-carboxaldehyde,1-(fluoromethyl)-(9CI)'s structural features also make it a promising candidate for applications in medicinal chemistry. It can be used to design and synthesize new drug molecules with improved binding affinity, selectivity, and therapeutic potential.
Check Digit Verification of cas no
The CAS Registry Mumber 118469-08-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,8,4,6 and 9 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 118469-08:
(8*1)+(7*1)+(6*8)+(5*4)+(4*6)+(3*9)+(2*0)+(1*8)=142
142 % 10 = 2
So 118469-08-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H7FN2O/c10-6-12-8-4-2-1-3-7(8)11-9(12)5-13/h1-5H,6H2
