1184963-68-5 Usage
General Description
2,6-diazaspiro[3.3]heptane is a chemical compound with a unique ring structure consisting of two nitrogen atoms and a seven-membered ring. It is commonly used as a building block in organic synthesis and pharmaceutical research, as it can be easily functionalized to create a wide variety of compounds with different properties and applications. This chemical has been studied for its potential as a ligand in coordination chemistry and as a catalyst in organic reactions. Its spirocyclic structure gives it a distinct three-dimensional shape, making it particularly useful in the development of chiral compounds for asymmetric synthesis. Additionally, 2,6-diazaspiro[3.3]heptane has demonstrated biological activity and is being investigated for its potential pharmacological applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1184963-68-5 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,1,8,4,9,6 and 3 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 1184963-68:
(9*1)+(8*1)+(7*8)+(6*4)+(5*9)+(4*6)+(3*3)+(2*6)+(1*8)=195
195 % 10 = 5
So 1184963-68-5 is a valid CAS Registry Number.
InChI:InChI=1S/C5H10N2.2ClH/c1-5(2-6-1)3-7-4-5;;/h6-7H,1-4H2;2*1H
