118609-68-0 Usage
General Description
FMOC-GLN-OH, also known as N- (9-Fluorenylmethoxycarbonyl)-L-glutamine, is a chemical compound used in the field of peptide synthesis. As an Fmoc amino acid, it has a protective group (Fmoc), which makes it useful in solid-phase peptide synthesis where amino acids are sequentially added to a growing chain. Its molecular formula is C22H21N3O5 and it has a molecular weight of 407.42 g/mol. FMOC-GLN-OH is commonly used in biochemistry and medicinal chemistry research, specifically in the development of peptide-based drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 118609-68-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,8,6,0 and 9 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 118609-68:
(8*1)+(7*1)+(6*8)+(5*6)+(4*0)+(3*9)+(2*6)+(1*8)=140
140 % 10 = 0
So 118609-68-0 is a valid CAS Registry Number.
InChI:InChI=1/C20H20N2O5/c21-18(23)10-9-17(19(24)25)22-20(26)27-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16-17H,9-11H2,(H2,21,23)(H,22,26)(H,24,25)