118803-81-9 Usage
Description
QUINOLINE-3-CARBOXYLIC ACID is an organic compound belonging to the quinoline family, characterized by a carboxylic acid functional group attached to the third position of the quinoline ring. It is known for its diverse chemical properties and potential applications in various industries.
Uses
Used in Pharmaceutical Industry:
QUINOLINE-3-CARBOXYLIC ACID is used as an intermediate compound for the synthesis of various pharmaceuticals, including antibiotics and anti-inflammatory drugs. Its unique chemical structure allows for the development of new drugs with improved solubility and bioavailability.
Used in Chemical Synthesis:
In the field of chemical synthesis, QUINOLINE-3-CARBOXYLIC ACID serves as a key building block for the creation of more complex organic molecules. Its reactivity and functional group make it a versatile component in the synthesis of various chemical products.
Used in Research and Development:
As a research compound, QUINOLINE-3-CARBOXYLIC ACID is utilized in the study of quinoline-based compounds and their potential applications in various fields. It aids in understanding the structure-activity relationships and the development of new compounds with specific properties and functions.
Used in Antimicrobial Applications:
QUINOLINE-3-CARBOXYLIC ACID and its derivatives have shown potential as antimicrobial agents, particularly against bacterial infections. They can be used as additives in the development of new antimicrobial products, such as disinfectants and sanitizers.
Used in Drug Delivery Systems:
Similar to gallotannin, QUINOLINE-3-CARBOXYLIC ACID can be incorporated into drug delivery systems to enhance the efficacy and bioavailability of various pharmaceuticals. Its chemical properties make it suitable for use in the development of novel drug carriers and targeted drug delivery platforms.
Check Digit Verification of cas no
The CAS Registry Mumber 118803-81-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,8,8,0 and 3 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 118803-81:
(8*1)+(7*1)+(6*8)+(5*8)+(4*0)+(3*3)+(2*8)+(1*1)=129
129 % 10 = 9
So 118803-81-9 is a valid CAS Registry Number.
InChI:InChI=1/C16H18FN3O3.C6H5NO2/c1-2-19-9-11(16(22)23)15(21)10-7-12(17)14(8-13(10)19)20-5-3-18-4-6-20;8-6(9)5-2-1-3-7-4-5/h7-9,18H,2-6H2,1H3,(H,22,23);1-4H,(H,8,9)