118804-39-0 Usage
Uses
Used in Pharmaceutical Industry:
3-Bromo-2-chloroaniline serves as a crucial intermediate in the synthesis of pharmaceuticals, contributing to the development of new medications due to its unique chemical structure and reactivity.
Used in Agrochemical Industry:
In the agrochemical sector, 3-Bromo-2-chloroaniline is utilized as an intermediate for the production of various agrochemicals, playing a part in creating compounds that protect crops and enhance agricultural productivity.
Used as a Dye Intermediate:
3-Bromo-2-chloroaniline is employed in the dye industry as an intermediate, facilitating the creation of dyes with specific color properties and stability, which are essential for textiles and other applications.
Used in Organic Synthesis:
3-Bromo-2-chloroaniline is also used in organic synthesis for the preparation of various organic compounds, showcasing its versatility in chemical reactions and the synthesis of complex molecules.
Safety Note:
Given its classification as a hazardous substance, 3-Bromo-2-chloroaniline requires careful handling to prevent skin and eye irritation, and potential harm from ingestion or inhalation. Proper safety measures should be implemented during its use in any application.
Check Digit Verification of cas no
The CAS Registry Mumber 118804-39-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,8,8,0 and 4 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 118804-39:
(8*1)+(7*1)+(6*8)+(5*8)+(4*0)+(3*4)+(2*3)+(1*9)=130
130 % 10 = 0
So 118804-39-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BrClN/c7-4-2-1-3-5(9)6(4)8/h1-3H,9H2
