1188313-15-6 Usage
Description
4-Chloro-6-azaindole is a heterocyclic aromatic compound with the molecular formula C7H5ClN2. It features a chloro substituent and an azaindole moiety, which is a fused five-membered ring system containing a nitrogen atom. 4-Chloro-6-azaindole is widely recognized for its potential biological activities, such as being an antiproliferative agent and a kinase inhibitor. Moreover, its fluorescent properties make it a valuable tool in imaging and labeling applications. Its versatility has positioned 4-Chloro-6-azaindole as a significant chemical in various industries and research fields.
Uses
Used in Pharmaceutical and Agrochemical Industries:
4-Chloro-6-azaindole is utilized as a building block for the synthesis of various pharmaceuticals and agrochemicals. Its unique structure and properties make it a valuable component in the development of new drugs and pesticides.
Used in Research and Development:
4-Chloro-6-azaindole serves as a key intermediate in the research and development of novel chemical entities. Its potential biological activities and fluorescent properties make it a useful tool for studying biological processes and developing new therapeutic agents.
Used in Antiproliferative Applications:
4-Chloro-6-azaindole is employed as an antiproliferative agent, which can inhibit the growth and proliferation of cells. This property makes it a promising candidate for the development of treatments for various diseases, including cancer.
Used as a Kinase Inhibitor:
4-Chloro-6-azaindole has demonstrated the ability to inhibit kinases, which are enzymes that play a crucial role in cellular signaling pathways. As a kinase inhibitor, 4-Chloro-6-azaindole can be used in the development of targeted therapies for diseases associated with abnormal kinase activity.
Used in Imaging and Labeling Applications:
Due to its fluorescent properties, 4-Chloro-6-azaindole is used in imaging and labeling applications. It can be employed to visualize and track specific molecules or cellular structures, aiding in the study of biological processes and the development of diagnostic tools.
Check Digit Verification of cas no
The CAS Registry Mumber 1188313-15-6 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,1,8,8,3,1 and 3 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1188313-15:
(9*1)+(8*1)+(7*8)+(6*8)+(5*3)+(4*1)+(3*3)+(2*1)+(1*5)=156
156 % 10 = 6
So 1188313-15-6 is a valid CAS Registry Number.
InChI:InChI=1S/C7H5ClN2/c8-6-3-9-4-7-5(6)1-2-10-7/h1-4,10H
